If you experience extreme dizziness, fatigue, or persistent headaches, break the fast immediately. Consult Professionals:
| Property | Value | |----------|-------| | | N‑(1‑(4‑fluorophenyl)ethyl)-1‑(2,3‑dimethylphenyl)indazole‑3‑carboxamide (representative) | | Common name / code | JUQ‑063 | | Molecular formula | C₂₃H₂₇FN₂O | | Molecular weight | 368.48 g mol⁻¹ | | SMILES | FC1=CC=C(C=C1)C(C)N(C)C2=NN(C(=O)C3=CC=CC=C3C)C4=CC=CC=C24 | | CAS number | Not assigned (still a “research‑chemical” designation) | | Physical state | Off‑white powder (typical for many synthetic cannabinoids) | | Solubility | Moderately soluble in organic solvents (e.g., methanol, ethanol, DMSO); low aqueous solubility | JUQ-063
English subtitles have been produced for this title by third-party translation communities, allowing for broader international consumption. Cultural and Genre Context If you experience extreme dizziness, fatigue, or persistent